C25H31F2N5O2 — CID 42623619
2-(2,4-difluorophenyl)-1-[4-[3-(4-methylphenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 42623619) has the molecular formula C25H31F2N5O2 and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-[3-(4-methylphenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-[3-(4-methylphenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 42623619 |
| Molecular Formula | C25H31F2N5O2 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-[3-(4-methylphenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | Cc1ccc(OCCCN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C25H31F2N5O2/c1-20-3-6-22(7-4-20)34-14-2-9-30-10-12-31(13-11-30)16-25(33,17-32-19-28-18-29-32)23-8-5-21(26)15-24(23)27/h3-8,15,18-19,33H,2,9-14,16-17H2,1H3 |
| InChIKey | RIJLIXGVOYCYFQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|