C24H28F3N5O2 — CID 42623622
2-(2,4-difluorophenyl)-1-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 42623622) has the molecular formula C24H28F3N5O2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 42623622 |
| Molecular Formula | C24H28F3N5O2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | OC(CN1CCN(CCCOc2ccc(F)cc2)CC1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H28F3N5O2/c25-19-2-5-21(6-3-19)34-13-1-8-30-9-11-31(12-10-30)15-24(33,16-32-18-28-17-29-32)22-7-4-20(26)14-23(22)27/h2-7,14,17-18,33H,1,8-13,15-16H2 |
| InChIKey | CWPTVPYDKWPXEM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|