C24H30F2N6O2 — CID 42623859
1-[4-[3-(4-aminophenoxy)propyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 42623859) has the molecular formula C24H30F2N6O2 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-[4-[3-(4-aminophenoxy)propyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-[4-[3-(4-aminophenoxy)propyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 42623859 |
| Molecular Formula | C24H30F2N6O2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 1-[4-[3-(4-aminophenoxy)propyl]piperazin-1-yl]-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | Nc1ccc(OCCCN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C24H30F2N6O2/c25-19-2-7-22(23(26)14-19)24(33,16-32-18-28-17-29-32)15-31-11-9-30(10-12-31)8-1-13-34-21-5-3-20(27)4-6-21/h2-7,14,17-18,33H,1,8-13,15-16,27H2 |
| InChIKey | FKRLVPNDXDELIF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|