About (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine
(E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine (PubChem CID 42624093) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine |
| PubChem CID | 42624093 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine |
| SMILES | NC/C=C(/F)COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F3NO/c11-7(3-4-14)6-15-8-1-2-9(12)10(13)5-8/h1-3,5H,4,6,14H2/b7-3+ |
| InChIKey | WASPRTQJQMWTAE-XVNBXDOJSA-N |
| XLogP | 2.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine?
The IUPAC name of (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine (CID 42624093) is (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine.
What is the SMILES notation for (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine?
The canonical SMILES for (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine is NC/C=C(/F)COc1ccc(F)c(F)c1.
What is the InChIKey of (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine?
The InChIKey is WASPRTQJQMWTAE-XVNBXDOJSA-N. The full InChI is InChI=1S/C10H10F3NO/c11-7(3-4-14)6-15-8-1-2-9(12)10(13)5-8/h1-3,5H,4,6,14H2/b7-3+.
What are the key properties of (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine?
(E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine has a molecular weight of 217.19 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,4-difluorophenoxy)-3-fluorobut-2-en-1-amine is sourced from PubChem (CID 42624093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).