C21H18O5S — CID 42624509
(11R,15R,17S)-2,9-dimethoxy-17-thiophen-2-yl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9-pentaen-13-one (PubChem CID 42624509) has the molecular formula C21H18O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is (11R,15R,17S)-2,9-dimethoxy-17-thiophen-2-yl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9-pentaen-13-one.
| Compound Name | (11R,15R,17S)-2,9-dimethoxy-17-thiophen-2-yl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9-pentaen-13-one |
|---|---|
| PubChem CID | 42624509 |
| Molecular Formula | C21H18O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (11R,15R,17S)-2,9-dimethoxy-17-thiophen-2-yl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1,3,5,7,9-pentaen-13-one |
| SMILES | COc1c2c(c(OC)c3ccccc13)[C@H]1OC(=O)C[C@H]1O[C@@H]2c1cccs1 |
| InChI | InChI=1S/C21H18O5S/c1-23-18-11-6-3-4-7-12(11)19(24-2)17-16(18)20-13(10-15(22)26-20)25-21(17)14-8-5-9-27-14/h3-9,13,20-21H,10H2,1-2H3/t13-,20+,21-/m1/s1 |
| InChIKey | KBIHQHPGQZHSRV-HBUDHLSFSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |