C25H24O6 — CID 42624567
ethyl 2-[(1S,3S)-5,10-dioxo-1-(phenylmethoxymethyl)-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate (PubChem CID 42624567) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is ethyl 2-[(1S,3S)-5,10-dioxo-1-(phenylmethoxymethyl)-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate.
| Compound Name | ethyl 2-[(1S,3S)-5,10-dioxo-1-(phenylmethoxymethyl)-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
|---|---|
| PubChem CID | 42624567 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | ethyl 2-[(1S,3S)-5,10-dioxo-1-(phenylmethoxymethyl)-3,4-dihydro-1H-benzo[g]isochromen-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CC2=C(C(=O)c3ccccc3C2=O)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C25H24O6/c1-2-30-22(26)13-17-12-20-23(25(28)19-11-7-6-10-18(19)24(20)27)21(31-17)15-29-14-16-8-4-3-5-9-16/h3-11,17,21H,2,12-15H2,1H3/t17-,21+/m0/s1 |
| InChIKey | GYHRXICLGBELQE-LAUBAEHRSA-N |
| XLogP | 3.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|