C18H17F3N2O — CID 42624629
2,2,2-trifluoro-1-(3-methylidene-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraen-7-yl)ethanone (PubChem CID 42624629) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-methylidene-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraen-7-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-methylidene-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraen-7-yl)ethanone |
|---|---|
| PubChem CID | 42624629 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-methylidene-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraen-7-yl)ethanone |
| SMILES | C=C1CC2CN(C(=O)C(F)(F)F)CCc3c2n(c2ccccc32)C1 |
| InChI | InChI=1S/C18H17F3N2O/c1-11-8-12-10-22(17(24)18(19,20)21)7-6-14-13-4-2-3-5-15(13)23(9-11)16(12)14/h2-5,12H,1,6-10H2 |
| InChIKey | XJYKECQCHARLBS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|