C13H9F3N4OS2 — CID 4262516
2-(1-methylimidazol-2-yl)sulfanyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 4262516) has the molecular formula C13H9F3N4OS2 and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)sulfanyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4262516 |
| Molecular Formula | C13H9F3N4OS2 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)sulfanyl-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cn1ccnc1SCC(=O)Nc1nc2c(F)c(F)c(F)cc2s1 |
| InChI | InChI=1S/C13H9F3N4OS2/c1-20-3-2-17-13(20)22-5-8(21)18-12-19-11-7(23-12)4-6(14)9(15)10(11)16/h2-4H,5H2,1H3,(H,18,19,21) |
| InChIKey | FRFSCOAILFGACV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|