C20H13ClF3N5O2S — CID 42625162
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)oxy]phenyl]thiourea (PubChem CID 42625162) has the molecular formula C20H13ClF3N5O2S and a molecular weight of 479.87 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)oxy]phenyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)oxy]phenyl]thiourea |
|---|---|
| PubChem CID | 42625162 |
| Molecular Formula | C20H13ClF3N5O2S |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-[(2-oxo-1,3-dihydroimidazo[4,5-b]pyridin-7-yl)oxy]phenyl]thiourea |
| SMILES | O=c1[nH]c2nccc(Oc3ccc(NC(=S)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)c2[nH]1 |
| InChI | InChI=1S/C20H13ClF3N5O2S/c21-14-6-3-11(9-13(14)20(22,23)24)27-19(32)26-10-1-4-12(5-2-10)31-15-7-8-25-17-16(15)28-18(30)29-17/h1-9H,(H2,26,27,32)(H2,25,28,29,30) |
| InChIKey | QWJTVLQZCAHVHX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|