About 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid
2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid (PubChem CID 42625213) has the molecular formula C19H15N3O3S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid |
| PubChem CID | 42625213 |
| Molecular Formula | C19H15N3O3S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid |
| SMILES | O=C(CCc1cn2c(n1)sc1ccccc12)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H15N3O3S/c23-17(21-14-6-2-1-5-13(14)18(24)25)10-9-12-11-22-15-7-3-4-8-16(15)26-19(22)20-12/h1-8,11H,9-10H2,(H,21,23)(H,24,25) |
| InChIKey | FRKCVFRGEZCWGJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid?
The IUPAC name of 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid (CID 42625213) is 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid.
What is the SMILES notation for 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid?
The canonical SMILES for 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid is O=C(CCc1cn2c(n1)sc1ccccc12)Nc1ccccc1C(=O)O.
What is the InChIKey of 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid?
The InChIKey is FRKCVFRGEZCWGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O3S/c23-17(21-14-6-2-1-5-13(14)18(24)25)10-9-12-11-22-15-7-3-4-8-16(15)26-19(22)20-12/h1-8,11H,9-10H2,(H,21,23)(H,24,25).
What are the key properties of 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid?
2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid has a molecular weight of 365.41 g/mol, XLogP of 3.82, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylpropanoylamino)benzoic acid is sourced from PubChem (CID 42625213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).