C18H27NO10 — CID 42625287
[(3S,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] butanoate (PubChem CID 42625287) has the molecular formula C18H27NO10 and a molecular weight of 417.41 g/mol. Its IUPAC name is [(3S,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] butanoate.
| Compound Name | [(3S,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] butanoate |
|---|---|
| PubChem CID | 42625287 |
| Molecular Formula | C18H27NO10 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [(3S,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl] butanoate |
| SMILES | CCCC(=O)OC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C18H27NO10/c1-6-7-14(24)29-18-15(19-9(2)20)17(27-12(5)23)16(26-11(4)22)13(28-18)8-25-10(3)21/h13,15-18H,6-8H2,1-5H3,(H,19,20)/t13-,15+,16-,17-,18?/m1/s1 |
| InChIKey | SDHLHFVBDOEAQI-GAMQSXCYSA-N |
| XLogP | -0.01 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|