About cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone
cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 42625462) has the molecular formula C14H15Cl3N2O3S
and a molecular weight of 397.71 g/mol. Its IUPAC name is cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone |
| PubChem CID | 42625462 |
| Molecular Formula | C14H15Cl3N2O3S |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCN(S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C14H15Cl3N2O3S/c15-10-7-12(17)13(8-11(10)16)23(21,22)19-5-3-18(4-6-19)14(20)9-1-2-9/h7-9H,1-6H2 |
| InChIKey | MCULMARMAXIZPR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone?
The IUPAC name of cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone (CID 42625462) is cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone?
The canonical SMILES for cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone is O=C(C1CC1)N1CCN(S(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)CC1.
What is the InChIKey of cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone?
The InChIKey is MCULMARMAXIZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl3N2O3S/c15-10-7-12(17)13(8-11(10)16)23(21,22)19-5-3-18(4-6-19)14(20)9-1-2-9/h7-9H,1-6H2.
What are the key properties of cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone?
cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone has a molecular weight of 397.71 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-(2,4,5-trichlorophenyl)sulfonylpiperazin-1-yl]methanone is sourced from PubChem (CID 42625462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).