C19H18N6O — CID 42626003
7-(cyclopentylamino)-4-phenyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10,12-pentaen-3-one (PubChem CID 42626003) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 7-(cyclopentylamino)-4-phenyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10,12-pentaen-3-one.
| Compound Name | 7-(cyclopentylamino)-4-phenyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10,12-pentaen-3-one |
|---|---|
| PubChem CID | 42626003 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 7-(cyclopentylamino)-4-phenyl-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),5,7,10,12-pentaen-3-one |
| SMILES | O=c1n(-c2ccccc2)nc2c(NC3CCCC3)nc3ncccc3n12 |
| InChI | InChI=1S/C19H18N6O/c26-19-24-15-11-6-12-20-16(15)22-17(21-13-7-4-5-8-13)18(24)23-25(19)14-9-2-1-3-10-14/h1-3,6,9-13H,4-5,7-8H2,(H,20,21,22) |
| InChIKey | NWDKFYOWSMUWPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |