C28H32N2O9 — CID 42626067
[(2R,3S,6S,7R,8R)-8-benzyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate (PubChem CID 42626067) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is [(2R,3S,6S,7R,8R)-8-benzyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,6S,7R,8R)-8-benzyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 42626067 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | [(2R,3S,6S,7R,8R)-8-benzyl-3-[(3-formamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@@H](C)OC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C28H32N2O9/c1-15(2)26(34)39-24-17(4)38-28(36)22(30-25(33)19-11-8-12-21(23(19)32)29-14-31)16(3)37-27(35)20(24)13-18-9-6-5-7-10-18/h5-12,14-17,20,22,24,32H,13H2,1-4H3,(H,29,31)(H,30,33)/t16-,17+,20-,22+,24+/m1/s1 |
| InChIKey | POEKVQXERPXKAO-NIBHENIISA-N |
| XLogP | 2.36 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|