About [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide
[(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide (PubChem CID 42626529) has the molecular formula C10H19AlF3N2O4-
and a molecular weight of 315.25 g/mol. Its IUPAC name is [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide.
Molecular Properties
| Compound Name | [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide |
| PubChem CID | 42626529 |
| Molecular Formula | C10H19AlF3N2O4- |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide |
| SMILES | C[C@H](N)[C@@H](CCCCCC(=O)O)NC(=O)O[Al-](F)(F)F |
| InChI | InChI=1S/C10H20N2O4.Al.3FH/c1-7(11)8(12-10(15)16)5-3-2-4-6-9(13)14;;;;/h7-8,12H,2-6,11H2,1H3,(H,13,14)(H,15,16);;3*1H/q;+3;;;/p-4/t7-,8+;;;;/m0..../s1 |
| InChIKey | YXYIADHJEQLYPU-JWQBCWJNSA-J |
| XLogP | 1.81 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide?
The IUPAC name of [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide (CID 42626529) is [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide.
What is the SMILES notation for [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide?
The canonical SMILES for [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide is C[C@H](N)[C@@H](CCCCCC(=O)O)NC(=O)O[Al-](F)(F)F.
What is the InChIKey of [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide?
The InChIKey is YXYIADHJEQLYPU-JWQBCWJNSA-J. The full InChI is InChI=1S/C10H20N2O4.Al.3FH/c1-7(11)8(12-10(15)16)5-3-2-4-6-9(13)14;;;;/h7-8,12H,2-6,11H2,1H3,(H,13,14)(H,15,16);;3*1H/q;+3;;;/p-4/t7-,8+;;;;/m0..../s1.
What are the key properties of [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide?
[(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide has a molecular weight of 315.25 g/mol, XLogP of 1.81, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3R)-2-amino-8-carboxyoctan-3-yl]carbamoyloxy-trifluoroalumanuide is sourced from PubChem (CID 42626529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).