About azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane
azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane (PubChem CID 42626599) has the molecular formula C5H15NO6P2+2
and a molecular weight of 247.12 g/mol. Its IUPAC name is azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane.
Molecular Properties
| Compound Name | azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane |
| PubChem CID | 42626599 |
| Molecular Formula | C5H15NO6P2+2 |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane |
| SMILES | C.C[C@@H](C[P+](=O)O[P+](=O)O)C(=O)O.N |
| InChI | InChI=1S/C4H6O6P2.CH4.H3N/c1-3(4(5)6)2-11(7)10-12(8)9;;/h3H,2H2,1H3;1H4;1H3/p+2/t3-;;/m0../s1 |
| InChIKey | AGJSTFOXIUJSST-QTNFYWBSSA-P |
| XLogP | 1.91 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane?
The IUPAC name of azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane (CID 42626599) is azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane.
What is the SMILES notation for azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane?
The canonical SMILES for azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane is C.C[C@@H](C[P+](=O)O[P+](=O)O)C(=O)O.N.
What is the InChIKey of azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane?
The InChIKey is AGJSTFOXIUJSST-QTNFYWBSSA-P. The full InChI is InChI=1S/C4H6O6P2.CH4.H3N/c1-3(4(5)6)2-11(7)10-12(8)9;;/h3H,2H2,1H3;1H4;1H3/p+2/t3-;;/m0../s1.
What are the key properties of azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane?
azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane has a molecular weight of 247.12 g/mol, XLogP of 1.91, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[(2R)-2-carboxypropyl]-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium;methane is sourced from PubChem (CID 42626599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).