C8H16O7S — CID 42627167
(2S,3R,4S,5S,6R)-2-ethylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 42627167) has the molecular formula C8H16O7S and a molecular weight of 256.28 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-ethylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-ethylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 42627167 |
| Molecular Formula | C8H16O7S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-ethylsulfonyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCS(=O)(=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O7S/c1-2-16(13,14)8-7(12)6(11)5(10)4(3-9)15-8/h4-12H,2-3H2,1H3/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | OFMOVPVQFRZDRQ-CBQIKETKSA-N |
| XLogP | -2.78 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |