C8H14N2O5 — CID 42627375
(2S,3S,4R,5S)-5-acetamido-3,4-dihydroxyoxane-2-carboxamide (PubChem CID 42627375) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2S,3S,4R,5S)-5-acetamido-3,4-dihydroxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5S)-5-acetamido-3,4-dihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 42627375 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2S,3S,4R,5S)-5-acetamido-3,4-dihydroxyoxane-2-carboxamide |
| SMILES | CC(=O)N[C@H]1CO[C@H](C(N)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14N2O5/c1-3(11)10-4-2-15-7(8(9)14)6(13)5(4)12/h4-7,12-13H,2H2,1H3,(H2,9,14)(H,10,11)/t4-,5+,6-,7-/m0/s1 |
| InChIKey | YEOFTFPZALLVIF-VZFHVOOUSA-N |
| XLogP | -2.90 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |