About 4-methylcyclohexa-2,5-dien-1-amine
4-methylcyclohexa-2,5-dien-1-amine (PubChem CID 42627495) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 4-methylcyclohexa-2,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-methylcyclohexa-2,5-dien-1-amine |
| PubChem CID | 42627495 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 4-methylcyclohexa-2,5-dien-1-amine |
| SMILES | CC1C=CC(N)C=C1 |
| InChI | InChI=1S/C7H11N/c1-6-2-4-7(8)5-3-6/h2-7H,8H2,1H3 |
| InChIKey | CXJSFCJNIFFFOE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylcyclohexa-2,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexa-2,5-dien-1-amine?
The IUPAC name of 4-methylcyclohexa-2,5-dien-1-amine (CID 42627495) is 4-methylcyclohexa-2,5-dien-1-amine.
What is the SMILES notation for 4-methylcyclohexa-2,5-dien-1-amine?
The canonical SMILES for 4-methylcyclohexa-2,5-dien-1-amine is CC1C=CC(N)C=C1.
What is the InChIKey of 4-methylcyclohexa-2,5-dien-1-amine?
The InChIKey is CXJSFCJNIFFFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-6-2-4-7(8)5-3-6/h2-7H,8H2,1H3.
What are the key properties of 4-methylcyclohexa-2,5-dien-1-amine?
4-methylcyclohexa-2,5-dien-1-amine has a molecular weight of 109.17 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-2,5-dien-1-amine is sourced from PubChem (CID 42627495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).