About 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine
1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine (PubChem CID 42627579) has the molecular formula C20H15Cl2N3
and a molecular weight of 368.27 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine |
| PubChem CID | 42627579 |
| Molecular Formula | C20H15Cl2N3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine |
| SMILES | Nc1nc2cccc(-c3ccccc3)c2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl2N3/c21-16-10-9-13(11-17(16)22)12-25-19-15(14-5-2-1-3-6-14)7-4-8-18(19)24-20(25)23/h1-11H,12H2,(H2,23,24) |
| InChIKey | JFVMZMBFRZPOFF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine (CID 42627579) is 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine is Nc1nc2cccc(-c3ccccc3)c2n1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine?
The InChIKey is JFVMZMBFRZPOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2N3/c21-16-10-9-13(11-17(16)22)12-25-19-15(14-5-2-1-3-6-14)7-4-8-18(19)24-20(25)23/h1-11H,12H2,(H2,23,24).
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine?
1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine has a molecular weight of 368.27 g/mol, XLogP of 5.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]-7-phenylbenzimidazol-2-amine is sourced from PubChem (CID 42627579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).