About 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran
7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran (PubChem CID 4262763) has the molecular formula C31H28O
and a molecular weight of 416.56 g/mol. Its IUPAC name is 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran.
Molecular Properties
| Compound Name | 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran |
| PubChem CID | 4262763 |
| Molecular Formula | C31H28O |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran |
| SMILES | CC(C)(C)c1coc2c(Cc3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C31H28O/c1-31(2,3)28-21-32-30-27(19-22-13-7-4-8-14-22)25(23-15-9-5-10-16-23)20-26(29(28)30)24-17-11-6-12-18-24/h4-18,20-21H,19H2,1-3H3 |
| InChIKey | YOYUJYCEGIKDTM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran?
The IUPAC name of 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran (CID 4262763) is 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran.
What is the SMILES notation for 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran?
The canonical SMILES for 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran is CC(C)(C)c1coc2c(Cc3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c12.
What is the InChIKey of 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran?
The InChIKey is YOYUJYCEGIKDTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H28O/c1-31(2,3)28-21-32-30-27(19-22-13-7-4-8-14-22)25(23-15-9-5-10-16-23)20-26(29(28)30)24-17-11-6-12-18-24/h4-18,20-21H,19H2,1-3H3.
What are the key properties of 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran?
7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran has a molecular weight of 416.56 g/mol, XLogP of 8.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-benzyl-3-tert-butyl-4,6-diphenyl-1-benzofuran is sourced from PubChem (CID 4262763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).