C28H48O — CID 42627703
(1S)-3-[2-[(1R,3aS,7aR)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethyl]-4-methylcyclohex-3-en-1-ol (PubChem CID 42627703) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is (1S)-3-[2-[(1R,3aS,7aR)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethyl]-4-methylcyclohex-3-en-1-ol.
| Compound Name | (1S)-3-[2-[(1R,3aS,7aR)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethyl]-4-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 42627703 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | (1S)-3-[2-[(1R,3aS,7aR)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethyl]-4-methylcyclohex-3-en-1-ol |
| SMILES | CC1=C(CCC2=CCC[C@]3(C)[C@@H]([C@H](C)CC[C@H](C)C(C)C)CC[C@@H]23)C[C@@H](O)CC1 |
| InChI | InChI=1S/C28H48O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h8,19-20,22,25-27,29H,7,9-18H2,1-6H3/t20-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | CQJQTHQEFNZKDZ-FWTXJDITSA-N |
| XLogP | 8.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|