C11H20N2O5 — CID 42627785
N-[(3R,4R,5S,6S)-2-amino-6-formyl-4,5-dihydroxyoxan-3-yl]pentanamide (PubChem CID 42627785) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[(3R,4R,5S,6S)-2-amino-6-formyl-4,5-dihydroxyoxan-3-yl]pentanamide.
| Compound Name | N-[(3R,4R,5S,6S)-2-amino-6-formyl-4,5-dihydroxyoxan-3-yl]pentanamide |
|---|---|
| PubChem CID | 42627785 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N-[(3R,4R,5S,6S)-2-amino-6-formyl-4,5-dihydroxyoxan-3-yl]pentanamide |
| SMILES | CCCCC(=O)N[C@H]1C(N)O[C@H](C=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H20N2O5/c1-2-3-4-7(15)13-8-10(17)9(16)6(5-14)18-11(8)12/h5-6,8-11,16-17H,2-4,12H2,1H3,(H,13,15)/t6-,8-,9-,10-,11?/m1/s1 |
| InChIKey | OVIZBQIKDCSYTE-FFLVSVRWSA-N |
| XLogP | -1.73 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|