C25H31NO3S — CID 42627927
2-[(3R,4R,4aS,8aR)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-1-phenylethanone (PubChem CID 42627927) has the molecular formula C25H31NO3S and a molecular weight of 425.59 g/mol. Its IUPAC name is 2-[(3R,4R,4aS,8aR)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-1-phenylethanone.
| Compound Name | 2-[(3R,4R,4aS,8aR)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 42627927 |
| Molecular Formula | C25H31NO3S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[(3R,4R,4aS,8aR)-4-methyl-2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-3-yl]-1-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CCCC[C@@H]3[C@@H](C)[C@H]2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H31NO3S/c1-18-12-14-22(15-13-18)30(28,29)26-17-21-10-6-7-11-23(21)19(2)24(26)16-25(27)20-8-4-3-5-9-20/h3-5,8-9,12-15,19,21,23-24H,6-7,10-11,16-17H2,1-2H3/t19-,21+,23-,24-/m1/s1 |
| InChIKey | FGAQQXQLQXZQNU-NZRJUOQRSA-N |
| XLogP | 5.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |