C34H34N2O5S2 — CID 42627932
2-[(4S,4aS,9bS)-4-methyl-2,5-bis-(4-methylphenyl)sulfonyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-3-yl]-1-phenylethanone (PubChem CID 42627932) has the molecular formula C34H34N2O5S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 2-[(4S,4aS,9bS)-4-methyl-2,5-bis-(4-methylphenyl)sulfonyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-3-yl]-1-phenylethanone.
| Compound Name | 2-[(4S,4aS,9bS)-4-methyl-2,5-bis-(4-methylphenyl)sulfonyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-3-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 42627932 |
| Molecular Formula | C34H34N2O5S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | 2-[(4S,4aS,9bS)-4-methyl-2,5-bis-(4-methylphenyl)sulfonyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-3-yl]-1-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3c4ccccc4N(S(=O)(=O)c4ccc(C)cc4)[C@@H]3[C@@H](C)C2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N2O5S2/c1-23-13-17-27(18-14-23)42(38,39)35-22-30-29-11-7-8-12-31(29)36(43(40,41)28-19-15-24(2)16-20-28)34(30)25(3)32(35)21-33(37)26-9-5-4-6-10-26/h4-20,25,30,32,34H,21-22H2,1-3H3/t25-,30+,32?,34+/m0/s1 |
| InChIKey | LVGSGNDZFKIZDX-DGIATLTJSA-N |
| XLogP | 5.95 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |