C24H33NO3S — CID 42627936
2-[(1S,2R,5R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]cyclohexan-1-one (PubChem CID 42627936) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is 2-[(1S,2R,5R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]cyclohexan-1-one.
| Compound Name | 2-[(1S,2R,5R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 42627936 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 2-[(1S,2R,5R,6R,7S,8R)-6-methyl-4-(4-methylphenyl)sulfonyl-4-azatricyclo[6.2.1.02,7]undecan-5-yl]cyclohexan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3[C@H]4CC[C@H](C4)[C@@H]3[C@@H](C)[C@@H]2C2CCCCC2=O)cc1 |
| InChI | InChI=1S/C24H33NO3S/c1-15-7-11-19(12-8-15)29(27,28)25-14-21-17-9-10-18(13-17)23(21)16(2)24(25)20-5-3-4-6-22(20)26/h7-8,11-12,16-18,20-21,23-24H,3-6,9-10,13-14H2,1-2H3/t16-,17+,18-,20?,21-,23+,24-/m1/s1 |
| InChIKey | FKSYPUAAFILRMY-TYUOCRBSSA-N |
| XLogP | 4.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |