About (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one
(5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one (PubChem CID 42628108) has the molecular formula C18H14FNO3
and a molecular weight of 311.31 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one |
| PubChem CID | 42628108 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(c2ccc(F)nc2)C[C@@H](c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C18H14FNO3/c19-18-4-2-12(9-20-18)14-5-13(6-15(21)7-14)11-1-3-16-17(8-11)23-10-22-16/h1-4,7-9,13H,5-6,10H2/t13-/m1/s1 |
| InChIKey | MQCKLNIFQUDINH-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one?
The IUPAC name of (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one (CID 42628108) is (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one.
What is the SMILES notation for (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one?
The canonical SMILES for (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one is O=C1C=C(c2ccc(F)nc2)C[C@@H](c2ccc3c(c2)OCO3)C1.
What is the InChIKey of (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one?
The InChIKey is MQCKLNIFQUDINH-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H14FNO3/c19-18-4-2-12(9-20-18)14-5-13(6-15(21)7-14)11-1-3-16-17(8-11)23-10-22-16/h1-4,7-9,13H,5-6,10H2/t13-/m1/s1.
What are the key properties of (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one?
(5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one has a molecular weight of 311.31 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(1,3-benzodioxol-5-yl)-3-(6-fluoro-3-pyridinyl)cyclohex-2-en-1-one is sourced from PubChem (CID 42628108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).