About N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide
N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide (PubChem CID 42628193) has the molecular formula C21H19NO4
and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide |
| PubChem CID | 42628193 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=CC(=O)C[C@H](c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C21H19NO4/c1-13(23)22-18-5-2-14(3-6-18)16-8-17(10-19(24)9-16)15-4-7-20-21(11-15)26-12-25-20/h2-7,9,11,17H,8,10,12H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | JPBNQHRXTIAVIH-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide?
The IUPAC name of N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide (CID 42628193) is N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide?
The canonical SMILES for N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide is CC(=O)Nc1ccc(C2=CC(=O)C[C@H](c3ccc4c(c3)OCO4)C2)cc1.
What is the InChIKey of N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide?
The InChIKey is JPBNQHRXTIAVIH-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H19NO4/c1-13(23)22-18-5-2-14(3-6-18)16-8-17(10-19(24)9-16)15-4-7-20-21(11-15)26-12-25-20/h2-7,9,11,17H,8,10,12H2,1H3,(H,22,23)/t17-/m1/s1.
What are the key properties of N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide?
N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide has a molecular weight of 349.39 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(5R)-5-(1,3-benzodioxol-5-yl)-3-oxocyclohexen-1-yl]phenyl]acetamide is sourced from PubChem (CID 42628193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).