About tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate
tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate (PubChem CID 42628246) has the molecular formula C19H27NO4
and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate.
Molecular Properties
| Compound Name | tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate |
| PubChem CID | 42628246 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO4/c1-18(2,3)23-16(21)15(20-17(22)24-19(4,5)6)13-12-14-10-8-7-9-11-14/h7-13,15H,1-6H3,(H,20,22)/b13-12+/t15-/m1/s1 |
| InChIKey | YDZYITQVLYVRAJ-RDRICISKSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate?
The IUPAC name of tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate (CID 42628246) is tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate.
What is the SMILES notation for tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate?
The canonical SMILES for tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate is CC(C)(C)OC(=O)N[C@H](/C=C/c1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate?
The InChIKey is YDZYITQVLYVRAJ-RDRICISKSA-N. The full InChI is InChI=1S/C19H27NO4/c1-18(2,3)23-16(21)15(20-17(22)24-19(4,5)6)13-12-14-10-8-7-9-11-14/h7-13,15H,1-6H3,(H,20,22)/b13-12+/t15-/m1/s1.
What are the key properties of tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate?
tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate has a molecular weight of 333.43 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbut-3-enoate is sourced from PubChem (CID 42628246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).