About 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one
2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one (PubChem CID 42628487) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one |
| PubChem CID | 42628487 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one |
| SMILES | C=CCN1c2ccccc2C(=O)CS1(=O)=O |
| InChI | InChI=1S/C11H11NO3S/c1-2-7-12-10-6-4-3-5-9(10)11(13)8-16(12,14)15/h2-6H,1,7-8H2 |
| InChIKey | CLJWLBXBKGSUOI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one?
The IUPAC name of 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one (CID 42628487) is 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one.
What is the SMILES notation for 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one?
The canonical SMILES for 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one is C=CCN1c2ccccc2C(=O)CS1(=O)=O.
What is the InChIKey of 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one?
The InChIKey is CLJWLBXBKGSUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-2-7-12-10-6-4-3-5-9(10)11(13)8-16(12,14)15/h2-6H,1,7-8H2.
What are the key properties of 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one?
2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one has a molecular weight of 237.28 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-1-prop-2-enyl-2λ6,1-benzothiazin-4-one is sourced from PubChem (CID 42628487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).