C33H54O9 — CID 42628602
(3E,7E,15E)-10,17,19,22,23-pentahydroxy-9-methoxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione (PubChem CID 42628602) has the molecular formula C33H54O9 and a molecular weight of 594.79 g/mol. Its IUPAC name is (3E,7E,15E)-10,17,19,22,23-pentahydroxy-9-methoxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione.
| Compound Name | (3E,7E,15E)-10,17,19,22,23-pentahydroxy-9-methoxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione |
|---|---|
| PubChem CID | 42628602 |
| Molecular Formula | C33H54O9 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | (3E,7E,15E)-10,17,19,22,23-pentahydroxy-9-methoxy-3,12,16,17,24,26-hexamethyl-14-methylidene-1-oxacyclohexacosa-3,7,15-triene-2,21-dione |
| SMILES | C=C1/C=C(\C)C(C)(O)CC(O)CC(=O)C(O)C(O)C(C)CC(C)OC(=O)/C(C)=C/CC/C=C/C(OC)C(O)CC(C)C1 |
| InChI | InChI=1S/C33H54O9/c1-20-14-21(2)16-27(35)29(41-8)13-11-9-10-12-22(3)32(39)42-25(6)17-23(4)30(37)31(38)28(36)18-26(34)19-33(7,40)24(5)15-20/h11-13,15,21,23,25-27,29-31,34-35,37-38,40H,1,9-10,14,16-19H2,2-8H3/b13-11+,22-12+,24-15+ |
| InChIKey | ROXBIOKRBVVCGL-COEXCEQZSA-N |
| XLogP | 3.72 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|