C29H25Cl2N3O5 — CID 42628984
6-[4-[[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-2-methylphenyl]-1-methylindole-3-carboxylic acid (PubChem CID 42628984) has the molecular formula C29H25Cl2N3O5 and a molecular weight of 566.44 g/mol. Its IUPAC name is 6-[4-[[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-2-methylphenyl]-1-methylindole-3-carboxylic acid.
| Compound Name | 6-[4-[[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-2-methylphenyl]-1-methylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 42628984 |
| Molecular Formula | C29H25Cl2N3O5 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 6-[4-[[3-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]-2-methylphenyl]-1-methylindole-3-carboxylic acid |
| SMILES | Cc1cc(OCc2c(-c3c(Cl)c[n+]([O-])cc3Cl)noc2C(C)C)ccc1-c1ccc2c(C(=O)O)cn(C)c2c1 |
| InChI | InChI=1S/C29H25Cl2N3O5/c1-15(2)28-22(27(32-39-28)26-23(30)12-34(37)13-24(26)31)14-38-18-6-8-19(16(3)9-18)17-5-7-20-21(29(35)36)11-33(4)25(20)10-17/h5-13,15H,14H2,1-4H3,(H,35,36) |
| InChIKey | VRMXGSVXDWHDBL-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|