C24H25NO2S — CID 42629136
1-benzothiophen-3-yl-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 42629136) has the molecular formula C24H25NO2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | 1-benzothiophen-3-yl-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 42629136 |
| Molecular Formula | C24H25NO2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-benzothiophen-3-yl-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | CC1(C)[C@H]2Cc3c(O)cccc3[C@]1(C)CCN2C(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C24H25NO2S/c1-23(2)21-13-16-18(8-6-9-19(16)26)24(23,3)11-12-25(21)22(27)17-14-28-20-10-5-4-7-15(17)20/h4-10,14,21,26H,11-13H2,1-3H3/t21-,24+/m1/s1 |
| InChIKey | UEMNBHVSWZYXIO-QPPBQGQZSA-N |
| XLogP | 5.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |