About [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate
[2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate (PubChem CID 42629143) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate |
| PubChem CID | 42629143 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate |
| SMILES | CC(C(OC(=O)c1ccccn1)c1ccccc1)N(C)C(=O)c1ccccn1 |
| InChI | InChI=1S/C22H21N3O3/c1-16(25(2)21(26)18-12-6-8-14-23-18)20(17-10-4-3-5-11-17)28-22(27)19-13-7-9-15-24-19/h3-16,20H,1-2H3 |
| InChIKey | PINWEVXZOZCWDU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate?
The IUPAC name of [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate (CID 42629143) is [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate.
What is the SMILES notation for [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate?
The canonical SMILES for [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate is CC(C(OC(=O)c1ccccn1)c1ccccc1)N(C)C(=O)c1ccccn1.
What is the InChIKey of [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate?
The InChIKey is PINWEVXZOZCWDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-16(25(2)21(26)18-12-6-8-14-23-18)20(17-10-4-3-5-11-17)28-22(27)19-13-7-9-15-24-19/h3-16,20H,1-2H3.
What are the key properties of [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate?
[2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate has a molecular weight of 375.43 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl(pyridine-2-carbonyl)amino]-1-phenylpropyl] pyridine-2-carboxylate is sourced from PubChem (CID 42629143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).