C26H25F3N6O3S — CID 42629311
1-ethyl-3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea (PubChem CID 42629311) has the molecular formula C26H25F3N6O3S and a molecular weight of 558.59 g/mol. Its IUPAC name is 1-ethyl-3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 42629311 |
| Molecular Formula | C26H25F3N6O3S |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | 1-ethyl-3-[4-[2-(4-morpholin-4-ylanilino)thieno[3,2-d]pyrimidin-7-yl]-2-(trifluoromethoxy)phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(-c2csc3cnc(Nc4ccc(N5CCOCC5)cc4)nc23)cc1OC(F)(F)F |
| InChI | InChI=1S/C26H25F3N6O3S/c1-2-30-25(36)33-20-8-3-16(13-21(20)38-26(27,28)29)19-15-39-22-14-31-24(34-23(19)22)32-17-4-6-18(7-5-17)35-9-11-37-12-10-35/h3-8,13-15H,2,9-12H2,1H3,(H2,30,33,36)(H,31,32,34) |
| InChIKey | TXPGVEQROBPCHN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|