About (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate
(4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate (PubChem CID 42629402) has the molecular formula C21H24N4O2
and a molecular weight of 364.45 g/mol. Its IUPAC name is (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate.
Molecular Properties
| Compound Name | (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate |
| PubChem CID | 42629402 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate |
| SMILES | CN1C2CCC1CN(C(=O)Oc1ccc(/N=N/c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C21H24N4O2/c1-24-18-9-10-19(24)15-25(14-13-18)21(26)27-20-11-7-17(8-12-20)23-22-16-5-3-2-4-6-16/h2-8,11-12,18-19H,9-10,13-15H2,1H3/b23-22+ |
| InChIKey | NHCXVFQLYYUJBY-GHVJWSGMSA-N |
| XLogP | 4.77 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate?
The IUPAC name of (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate (CID 42629402) is (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate.
What is the SMILES notation for (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate?
The canonical SMILES for (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate is CN1C2CCC1CN(C(=O)Oc1ccc(/N=N/c3ccccc3)cc1)CC2.
What is the InChIKey of (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate?
The InChIKey is NHCXVFQLYYUJBY-GHVJWSGMSA-N. The full InChI is InChI=1S/C21H24N4O2/c1-24-18-9-10-19(24)15-25(14-13-18)21(26)27-20-11-7-17(8-12-20)23-22-16-5-3-2-4-6-16/h2-8,11-12,18-19H,9-10,13-15H2,1H3/b23-22+.
What are the key properties of (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate?
(4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate has a molecular weight of 364.45 g/mol, XLogP of 4.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenyldiazenylphenyl) 9-methyl-3,9-diazabicyclo[4.2.1]nonane-3-carboxylate is sourced from PubChem (CID 42629402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).