C21H33NO2 — CID 4262968
8a-methyl-5-methylidene-3-[(4-methylpiperidin-1-yl)methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one (PubChem CID 4262968) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 8a-methyl-5-methylidene-3-[(4-methylpiperidin-1-yl)methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | 8a-methyl-5-methylidene-3-[(4-methylpiperidin-1-yl)methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 4262968 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 8a-methyl-5-methylidene-3-[(4-methylpiperidin-1-yl)methyl]-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C1CCCC2(C)CC3OC(=O)C(CN4CCC(C)CC4)C3CC12 |
| InChI | InChI=1S/C21H33NO2/c1-14-6-9-22(10-7-14)13-17-16-11-18-15(2)5-4-8-21(18,3)12-19(16)24-20(17)23/h14,16-19H,2,4-13H2,1,3H3 |
| InChIKey | BOMYGTQQWNDLEK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|