C22H27NO2 — CID 42629716
N-[3-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]acetamide (PubChem CID 42629716) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is N-[3-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]acetamide.
| Compound Name | N-[3-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42629716 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | N-[3-(7-methoxy-3-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]acetamide |
| SMILES | COc1ccc2c(c1)C(CCCNC(C)=O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C22H27NO2/c1-16(24)23-12-6-9-18-13-20(17-7-4-3-5-8-17)14-19-10-11-21(25-2)15-22(18)19/h3-5,7-8,10-11,15,18,20H,6,9,12-14H2,1-2H3,(H,23,24) |
| InChIKey | FWVARDNKSPQOSJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|