C18H11Cl2N5O — CID 42629826
3-(2,5-dichlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7-carbonitrile (PubChem CID 42629826) has the molecular formula C18H11Cl2N5O and a molecular weight of 384.23 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7-carbonitrile.
| Compound Name | 3-(2,5-dichlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7-carbonitrile |
|---|---|
| PubChem CID | 42629826 |
| Molecular Formula | C18H11Cl2N5O |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene-7-carbonitrile |
| SMILES | COc1ccc2nc(C#N)c3c(C)nc(-c4cc(Cl)ccc4Cl)n3c2n1 |
| InChI | InChI=1S/C18H11Cl2N5O/c1-9-16-14(8-21)23-13-5-6-15(26-2)24-18(13)25(16)17(22-9)11-7-10(19)3-4-12(11)20/h3-7H,1-2H3 |
| InChIKey | IKYLQHVXAXEUNZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |