C19H17N5O2 — CID 42629944
2-(12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)benzamide (PubChem CID 42629944) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 2-(12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)benzamide.
| Compound Name | 2-(12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)benzamide |
|---|---|
| PubChem CID | 42629944 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 2-(12-methoxy-5,7-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-3-yl)benzamide |
| SMILES | COc1ccc2nc(C)c3c(C)nc(-c4ccccc4C(N)=O)n3c2n1 |
| InChI | InChI=1S/C19H17N5O2/c1-10-16-11(2)22-18(13-7-5-4-6-12(13)17(20)25)24(16)19-14(21-10)8-9-15(23-19)26-3/h4-9H,1-3H3,(H2,20,25) |
| InChIKey | MRTYTTCXBBBUON-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |