About 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline
8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline (PubChem CID 42629951) has the molecular formula C19H16ClN3
and a molecular weight of 321.81 g/mol. Its IUPAC name is 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline.
Molecular Properties
| Compound Name | 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline |
| PubChem CID | 42629951 |
| Molecular Formula | C19H16ClN3 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline |
| SMILES | Cc1ccccc1-c1nc(C)c2c(C)nc3ccc(Cl)cc3n12 |
| InChI | InChI=1S/C19H16ClN3/c1-11-6-4-5-7-15(11)19-22-13(3)18-12(2)21-16-9-8-14(20)10-17(16)23(18)19/h4-10H,1-3H3 |
| InChIKey | YKDZLWKXZOOQGO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The IUPAC name of 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline (CID 42629951) is 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline.
What is the SMILES notation for 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The canonical SMILES for 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline is Cc1ccccc1-c1nc(C)c2c(C)nc3ccc(Cl)cc3n12.
What is the InChIKey of 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The InChIKey is YKDZLWKXZOOQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN3/c1-11-6-4-5-7-15(11)19-22-13(3)18-12(2)21-16-9-8-14(20)10-17(16)23(18)19/h4-10H,1-3H3.
What are the key properties of 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline has a molecular weight of 321.81 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline is sourced from PubChem (CID 42629951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).