C20H16F2N2O2S — CID 42630080
2-(2-benzyl-5,7-difluoro-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl)acetic acid (PubChem CID 42630080) has the molecular formula C20H16F2N2O2S and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-(2-benzyl-5,7-difluoro-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl)acetic acid.
| Compound Name | 2-(2-benzyl-5,7-difluoro-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl)acetic acid |
|---|---|
| PubChem CID | 42630080 |
| Molecular Formula | C20H16F2N2O2S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-(2-benzyl-5,7-difluoro-1-sulfanylidene-3,4-dihydropyrido[3,4-b]indol-9-yl)acetic acid |
| SMILES | O=C(O)Cn1c2c(c3c(F)cc(F)cc31)CCN(Cc1ccccc1)C2=S |
| InChI | InChI=1S/C20H16F2N2O2S/c21-13-8-15(22)18-14-6-7-23(10-12-4-2-1-3-5-12)20(27)19(14)24(11-17(25)26)16(18)9-13/h1-5,8-9H,6-7,10-11H2,(H,25,26) |
| InChIKey | QBQZUKSEKXJYCS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|