About 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol
8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol (PubChem CID 42630316) has the molecular formula C19H16FN3O
and a molecular weight of 321.36 g/mol. Its IUPAC name is 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol.
Molecular Properties
| Compound Name | 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol |
| PubChem CID | 42630316 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol |
| SMILES | Cc1ccccc1-c1nc(C)c2c(C)nc3c(O)cc(F)cc3n12 |
| InChI | InChI=1S/C19H16FN3O/c1-10-6-4-5-7-14(10)19-22-12(3)18-11(2)21-17-15(23(18)19)8-13(20)9-16(17)24/h4-9,24H,1-3H3 |
| InChIKey | CUCTWVMJSNSTKF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol?
The IUPAC name of 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol (CID 42630316) is 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol.
What is the SMILES notation for 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol?
The canonical SMILES for 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol is Cc1ccccc1-c1nc(C)c2c(C)nc3c(O)cc(F)cc3n12.
What is the InChIKey of 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol?
The InChIKey is CUCTWVMJSNSTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN3O/c1-10-6-4-5-7-14(10)19-22-12(3)18-11(2)21-17-15(23(18)19)8-13(20)9-16(17)24/h4-9,24H,1-3H3.
What are the key properties of 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol?
8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol has a molecular weight of 321.36 g/mol, XLogP of 4.32, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxalin-6-ol is sourced from PubChem (CID 42630316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).