About 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline
6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline (PubChem CID 42630438) has the molecular formula C21H20FN3O
and a molecular weight of 349.41 g/mol. Its IUPAC name is 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline.
Molecular Properties
| Compound Name | 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline |
| PubChem CID | 42630438 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline |
| SMILES | CCOc1cc(F)cc2c1nc(C)c1c(C)nc(-c3ccccc3C)n12 |
| InChI | InChI=1S/C21H20FN3O/c1-5-26-18-11-15(22)10-17-19(18)23-13(3)20-14(4)24-21(25(17)20)16-9-7-6-8-12(16)2/h6-11H,5H2,1-4H3 |
| InChIKey | SQZHNYUQGYHEOQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The IUPAC name of 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline (CID 42630438) is 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline.
What is the SMILES notation for 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The canonical SMILES for 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline is CCOc1cc(F)cc2c1nc(C)c1c(C)nc(-c3ccccc3C)n12.
What is the InChIKey of 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
The InChIKey is SQZHNYUQGYHEOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20FN3O/c1-5-26-18-11-15(22)10-17-19(18)23-13(3)20-14(4)24-21(25(17)20)16-9-7-6-8-12(16)2/h6-11H,5H2,1-4H3.
What are the key properties of 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline?
6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline has a molecular weight of 349.41 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-8-fluoro-3,4-dimethyl-1-(2-methylphenyl)imidazo[1,5-a]quinoxaline is sourced from PubChem (CID 42630438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).