About 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid
7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid (PubChem CID 42630803) has the molecular formula C27H24O5S
and a molecular weight of 460.55 g/mol. Its IUPAC name is 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid |
| PubChem CID | 42630803 |
| Molecular Formula | C27H24O5S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1COc1ccc2c(-c3ccc(S(C)(=O)=O)cc3)cc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C27H24O5S/c1-17-5-4-6-18(2)26(17)16-32-22-9-12-24-20(14-22)13-21(27(28)29)15-25(24)19-7-10-23(11-8-19)33(3,30)31/h4-15H,16H2,1-3H3,(H,28,29) |
| InChIKey | ULTYPPRAODPPDK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid?
The IUPAC name of 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid (CID 42630803) is 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid.
What is the SMILES notation for 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid?
The canonical SMILES for 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid is Cc1cccc(C)c1COc1ccc2c(-c3ccc(S(C)(=O)=O)cc3)cc(C(=O)O)cc2c1.
What is the InChIKey of 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid?
The InChIKey is ULTYPPRAODPPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O5S/c1-17-5-4-6-18(2)26(17)16-32-22-9-12-24-20(14-22)13-21(27(28)29)15-25(24)19-7-10-23(11-8-19)33(3,30)31/h4-15H,16H2,1-3H3,(H,28,29).
What are the key properties of 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid?
7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid has a molecular weight of 460.55 g/mol, XLogP of 5.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2,6-dimethylphenyl)methoxy]-4-(4-methylsulfonylphenyl)naphthalene-2-carboxylic acid is sourced from PubChem (CID 42630803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).