C10H4Cl3NOS2 — CID 42630846
(5Z)-4-sulfanylidene-5-[(2,3,5-trichlorophenyl)methylidene]-1,3-thiazolidin-2-one (PubChem CID 42630846) has the molecular formula C10H4Cl3NOS2 and a molecular weight of 324.64 g/mol. Its IUPAC name is (5Z)-4-sulfanylidene-5-[(2,3,5-trichlorophenyl)methylidene]-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-4-sulfanylidene-5-[(2,3,5-trichlorophenyl)methylidene]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 42630846 |
| Molecular Formula | C10H4Cl3NOS2 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 322.88 |
| IUPAC Name | (5Z)-4-sulfanylidene-5-[(2,3,5-trichlorophenyl)methylidene]-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/c2cc(Cl)cc(Cl)c2Cl)S1 |
| InChI | InChI=1S/C10H4Cl3NOS2/c11-5-1-4(8(13)6(12)3-5)2-7-9(16)14-10(15)17-7/h1-3H,(H,14,15,16)/b7-2- |
| InChIKey | LYEMMPWMYSZZDD-UQCOIBPSSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|