C24H28N4O5 — CID 42630940
(2R,3S,4R,5E)-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentane-1,2,3,4-tetrol (PubChem CID 42630940) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is (2R,3S,4R,5E)-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R,5E)-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 42630940 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (2R,3S,4R,5E)-5-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]pentane-1,2,3,4-tetrol |
| SMILES | COc1ccccc1Cc1cc(-c2ccc(C)cc2)nnc1N/N=C/[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H28N4O5/c1-15-7-9-16(10-8-15)19-12-18(11-17-5-3-4-6-22(17)33-2)24(28-26-19)27-25-13-20(30)23(32)21(31)14-29/h3-10,12-13,20-21,23,29-32H,11,14H2,1-2H3,(H,27,28)/b25-13+/t20-,21-,23+/m1/s1 |
| InChIKey | WAPPORWFQQGMEP-LRGHOVPJSA-N |
| XLogP | 1.52 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|