C31H34N4O9 — CID 42630943
[(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]pentyl] acetate (PubChem CID 42630943) has the molecular formula C31H34N4O9 and a molecular weight of 606.63 g/mol. Its IUPAC name is [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]pentyl] acetate.
| Compound Name | [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]pentyl] acetate |
|---|---|
| PubChem CID | 42630943 |
| Molecular Formula | C31H34N4O9 |
| Molecular Weight | 606.63 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]pentyl] acetate |
| SMILES | COc1ccccc1Cc1cc(-c2ccccc2)nnc1N/N=C/[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C31H34N4O9/c1-19(36)41-18-29(43-21(3)38)30(44-22(4)39)28(42-20(2)37)17-32-34-31-25(15-24-13-9-10-14-27(24)40-5)16-26(33-35-31)23-11-7-6-8-12-23/h6-14,16-17,28-30H,15,18H2,1-5H3,(H,34,35)/b32-17+/t28-,29-,30+/m1/s1 |
| InChIKey | UIUKYCGEALUSQC-MPTMAPNLSA-N |
| XLogP | 3.50 |
| TPSA | 164.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|