C31H33ClN4O9 — CID 42630944
[(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]pentyl] acetate (PubChem CID 42630944) has the molecular formula C31H33ClN4O9 and a molecular weight of 641.08 g/mol. Its IUPAC name is [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]pentyl] acetate.
| Compound Name | [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]pentyl] acetate |
|---|---|
| PubChem CID | 42630944 |
| Molecular Formula | C31H33ClN4O9 |
| Molecular Weight | 641.08 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | [(2R,3S,4R,5E)-2,3,4-triacetyloxy-5-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]pentyl] acetate |
| SMILES | COc1ccccc1Cc1cc(-c2ccc(Cl)cc2)nnc1N/N=C/[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C31H33ClN4O9/c1-18(37)42-17-29(44-20(3)39)30(45-21(4)40)28(43-19(2)38)16-33-35-31-24(14-23-8-6-7-9-27(23)41-5)15-26(34-36-31)22-10-12-25(32)13-11-22/h6-13,15-16,28-30H,14,17H2,1-5H3,(H,35,36)/b33-16+/t28-,29-,30+/m1/s1 |
| InChIKey | BYNPLLWOBSDVRN-PJCGRDDNSA-N |
| XLogP | 4.15 |
| TPSA | 164.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|