About (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one
(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 42630958) has the molecular formula C10H5Cl2NOS2
and a molecular weight of 290.20 g/mol. Its IUPAC name is (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| PubChem CID | 42630958 |
| Molecular Formula | C10H5Cl2NOS2 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 288.92 |
| IUPAC Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | O=C1NC(=S)/C(=C/c2c(Cl)cccc2Cl)S1 |
| InChI | InChI=1S/C10H5Cl2NOS2/c11-6-2-1-3-7(12)5(6)4-8-9(15)13-10(14)16-8/h1-4H,(H,13,14,15)/b8-4- |
| InChIKey | DNAWASXFWBCUIJ-YWEYNIOJSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one?
The IUPAC name of (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one (CID 42630958) is (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one.
What is the SMILES notation for (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one?
The canonical SMILES for (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one is O=C1NC(=S)/C(=C/c2c(Cl)cccc2Cl)S1.
What is the InChIKey of (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one?
The InChIKey is DNAWASXFWBCUIJ-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H5Cl2NOS2/c11-6-2-1-3-7(12)5(6)4-8-9(15)13-10(14)16-8/h1-4H,(H,13,14,15)/b8-4-.
What are the key properties of (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one?
(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one has a molecular weight of 290.20 g/mol, XLogP of 4.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-sulfanylidene-1,3-thiazolidin-2-one is sourced from PubChem (CID 42630958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).